C10H11N3O4S2 — CID 114916103
methyl 4-methyl-3-(1H-pyrazol-4-ylsulfonylamino)thiophene-2-carboxylate (PubChem CID 114916103) has the molecular formula C10H11N3O4S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is methyl 4-methyl-3-(1H-pyrazol-4-ylsulfonylamino)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-(1H-pyrazol-4-ylsulfonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114916103 |
| Molecular Formula | C10H11N3O4S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | methyl 4-methyl-3-(1H-pyrazol-4-ylsulfonylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H11N3O4S2/c1-6-5-18-9(10(14)17-2)8(6)13-19(15,16)7-3-11-12-4-7/h3-5,13H,1-2H3,(H,11,12) |
| InChIKey | IFYWFJPHEKMEQX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |