C10H10ClN3O2S — CID 66254277
N-(2-chloro-6-methylphenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 66254277) has the molecular formula C10H10ClN3O2S and a molecular weight of 271.73 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 66254277 |
| Molecular Formula | C10H10ClN3O2S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1cccc(Cl)c1NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H10ClN3O2S/c1-7-3-2-4-9(11)10(7)14-17(15,16)8-5-12-13-6-8/h2-6,14H,1H3,(H,12,13) |
| InChIKey | GQHOBXBHLYNIKG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |