C10H12N4O2S — CID 54937299
N-(5-amino-2-methylphenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 54937299) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(5-amino-2-methylphenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 54937299 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1ccc(N)cc1NS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H12N4O2S/c1-7-2-3-8(11)4-10(7)14-17(15,16)9-5-12-13-6-9/h2-6,14H,11H2,1H3,(H,12,13) |
| InChIKey | QKZKAKRFVPOAHD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|