C10H11N3O4S2 — CID 47267601
N-(3-methylsulfonylphenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 47267601) has the molecular formula C10H11N3O4S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3-methylsulfonylphenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 47267601 |
| Molecular Formula | C10H11N3O4S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CS(=O)(=O)c1cccc(NS(=O)(=O)c2cn[nH]c2)c1 |
| InChI | InChI=1S/C10H11N3O4S2/c1-18(14,15)9-4-2-3-8(5-9)13-19(16,17)10-6-11-12-7-10/h2-7,13H,1H3,(H,11,12) |
| InChIKey | IWQDOBSBKLXLGU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |