C9H7F2N3O2S — CID 60912012
N-(3,4-difluorophenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60912012) has the molecular formula C9H7F2N3O2S and a molecular weight of 259.24 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60912012 |
| Molecular Formula | C9H7F2N3O2S |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | N-(3,4-difluorophenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1)c1cn[nH]c1 |
| InChI | InChI=1S/C9H7F2N3O2S/c10-8-2-1-6(3-9(8)11)14-17(15,16)7-4-12-13-5-7/h1-5,14H,(H,12,13) |
| InChIKey | DMJSTDOJFKKBNA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |