C12H10FN3O4S — CID 77069486
3-[2-fluoro-4-(1H-pyrazol-4-ylsulfonylamino)phenyl]prop-2-enoic acid (PubChem CID 77069486) has the molecular formula C12H10FN3O4S and a molecular weight of 311.29 g/mol. Its IUPAC name is 3-[2-fluoro-4-(1H-pyrazol-4-ylsulfonylamino)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-fluoro-4-(1H-pyrazol-4-ylsulfonylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77069486 |
| Molecular Formula | C12H10FN3O4S |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 3-[2-fluoro-4-(1H-pyrazol-4-ylsulfonylamino)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(NS(=O)(=O)c2cn[nH]c2)cc1F |
| InChI | InChI=1S/C12H10FN3O4S/c13-11-5-9(3-1-8(11)2-4-12(17)18)16-21(19,20)10-6-14-15-7-10/h1-7,16H,(H,14,15)(H,17,18) |
| InChIKey | BLSXNXGOGIUWRQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|