C13H15FN4O2S — CID 60933682
N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60933682) has the molecular formula C13H15FN4O2S and a molecular weight of 310.35 g/mol. Its IUPAC name is N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60933682 |
| Molecular Formula | C13H15FN4O2S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(N2CCCC2)c(F)c1)c1cn[nH]c1 |
| InChI | InChI=1S/C13H15FN4O2S/c14-12-7-10(3-4-13(12)18-5-1-2-6-18)17-21(19,20)11-8-15-16-9-11/h3-4,7-9,17H,1-2,5-6H2,(H,15,16) |
| InChIKey | DAHYCFRSDPDFRR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|