C18H18BrFN2O4S — CID 55920968
methyl 2-bromo-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)sulfamoyl]benzoate (PubChem CID 55920968) has the molecular formula C18H18BrFN2O4S and a molecular weight of 457.32 g/mol. Its IUPAC name is methyl 2-bromo-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-bromo-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55920968 |
| Molecular Formula | C18H18BrFN2O4S |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | methyl 2-bromo-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2ccc(N3CCCC3)c(F)c2)ccc1Br |
| InChI | InChI=1S/C18H18BrFN2O4S/c1-26-18(23)14-11-13(5-6-15(14)19)27(24,25)21-12-4-7-17(16(20)10-12)22-8-2-3-9-22/h4-7,10-11,21H,2-3,8-9H2,1H3 |
| InChIKey | XPUKDWRKQFIDFR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|