C15H15BrN2O6S2 — CID 47066316
methyl 2-bromo-5-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]benzoate (PubChem CID 47066316) has the molecular formula C15H15BrN2O6S2 and a molecular weight of 463.33 g/mol. Its IUPAC name is methyl 2-bromo-5-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 2-bromo-5-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 47066316 |
| Molecular Formula | C15H15BrN2O6S2 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | methyl 2-bromo-5-[[4-(sulfamoylmethyl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2ccc(CS(N)(=O)=O)cc2)ccc1Br |
| InChI | InChI=1S/C15H15BrN2O6S2/c1-24-15(19)13-8-12(6-7-14(13)16)26(22,23)18-11-4-2-10(3-5-11)9-25(17,20)21/h2-8,18H,9H2,1H3,(H2,17,20,21) |
| InChIKey | ZKFPOEVQIMXRRL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |