C8H8BrNO4S — CID 43828340
methyl 2-bromo-5-sulfamoylbenzoate (PubChem CID 43828340) has the molecular formula C8H8BrNO4S and a molecular weight of 294.13 g/mol. Its IUPAC name is methyl 2-bromo-5-sulfamoylbenzoate.
| Compound Name | methyl 2-bromo-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 43828340 |
| Molecular Formula | C8H8BrNO4S |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | methyl 2-bromo-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C8H8BrNO4S/c1-14-8(11)6-4-5(15(10,12)13)2-3-7(6)9/h2-4H,1H3,(H2,10,12,13) |
| InChIKey | IQWBSPAOUYKERV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |