About methyl 2-bromo-5-methylbenzoate
methyl 2-bromo-5-methylbenzoate (PubChem CID 15110996) has the molecular formula C9H9BrO2
and a molecular weight of 229.07 g/mol. Its IUPAC name is methyl 2-bromo-5-methylbenzoate.
Molecular Properties
| Compound Name | methyl 2-bromo-5-methylbenzoate |
| PubChem CID | 15110996 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | methyl 2-bromo-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)ccc1Br |
| InChI | InChI=1S/C9H9BrO2/c1-6-3-4-8(10)7(5-6)9(11)12-2/h3-5H,1-2H3 |
| InChIKey | PYRAZCQFEMNXJA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-bromo-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-5-methylbenzoate?
The IUPAC name of methyl 2-bromo-5-methylbenzoate (CID 15110996) is methyl 2-bromo-5-methylbenzoate.
What is the SMILES notation for methyl 2-bromo-5-methylbenzoate?
The canonical SMILES for methyl 2-bromo-5-methylbenzoate is COC(=O)c1cc(C)ccc1Br.
What is the InChIKey of methyl 2-bromo-5-methylbenzoate?
The InChIKey is PYRAZCQFEMNXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO2/c1-6-3-4-8(10)7(5-6)9(11)12-2/h3-5H,1-2H3.
What are the key properties of methyl 2-bromo-5-methylbenzoate?
methyl 2-bromo-5-methylbenzoate has a molecular weight of 229.07 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-5-methylbenzoate is sourced from PubChem (CID 15110996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).