C18H16BrN3O4S — CID 60549403
methyl 5-[(1-benzylpyrazol-4-yl)sulfamoyl]-2-bromobenzoate (PubChem CID 60549403) has the molecular formula C18H16BrN3O4S and a molecular weight of 450.31 g/mol. Its IUPAC name is methyl 5-[(1-benzylpyrazol-4-yl)sulfamoyl]-2-bromobenzoate.
| Compound Name | methyl 5-[(1-benzylpyrazol-4-yl)sulfamoyl]-2-bromobenzoate |
|---|---|
| PubChem CID | 60549403 |
| Molecular Formula | C18H16BrN3O4S |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | methyl 5-[(1-benzylpyrazol-4-yl)sulfamoyl]-2-bromobenzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2cnn(Cc3ccccc3)c2)ccc1Br |
| InChI | InChI=1S/C18H16BrN3O4S/c1-26-18(23)16-9-15(7-8-17(16)19)27(24,25)21-14-10-20-22(12-14)11-13-5-3-2-4-6-13/h2-10,12,21H,11H2,1H3 |
| InChIKey | UQTWKROWHQBAPW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |