C25H26FN3O4S — CID 55946324
N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide (PubChem CID 55946324) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide.
| Compound Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 55946324 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-[(4-methoxyphenyl)sulfamoyl]-2-methylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)Nc3ccc(N4CCCC4)c(F)c3)c2)cc1 |
| InChI | InChI=1S/C25H26FN3O4S/c1-17-5-11-21(34(31,32)28-18-6-9-20(33-2)10-7-18)16-22(17)25(30)27-19-8-12-24(23(26)15-19)29-13-3-4-14-29/h5-12,15-16,28H,3-4,13-14H2,1-2H3,(H,27,30) |
| InChIKey | XWGPTHWDSNKPHS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|