C24H20N2O6S — CID 55978421
5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-(2-oxochromen-6-yl)benzamide (PubChem CID 55978421) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-(2-oxochromen-6-yl)benzamide.
| Compound Name | 5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-(2-oxochromen-6-yl)benzamide |
|---|---|
| PubChem CID | 55978421 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 5-[(4-methoxyphenyl)sulfamoyl]-2-methyl-N-(2-oxochromen-6-yl)benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)Nc3ccc4oc(=O)ccc4c3)c2)cc1 |
| InChI | InChI=1S/C24H20N2O6S/c1-15-3-10-20(33(29,30)26-17-5-8-19(31-2)9-6-17)14-21(15)24(28)25-18-7-11-22-16(13-18)4-12-23(27)32-22/h3-14,26H,1-2H3,(H,25,28) |
| InChIKey | HLKGWOCUVMGKFW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|