C19H20ClN3O5S — CID 5113515
methyl 2-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylanilino]-2-oxoacetate (PubChem CID 5113515) has the molecular formula C19H20ClN3O5S and a molecular weight of 437.91 g/mol. Its IUPAC name is methyl 2-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylanilino]-2-oxoacetate.
| Compound Name | methyl 2-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 5113515 |
| Molecular Formula | C19H20ClN3O5S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | methyl 2-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylanilino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C19H20ClN3O5S/c1-28-19(25)18(24)21-16-12-15(8-9-17(16)23-10-2-3-11-23)29(26,27)22-14-6-4-13(20)5-7-14/h4-9,12,22H,2-3,10-11H2,1H3,(H,21,24) |
| InChIKey | KGAFFLAZGRSQNP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|