C30H28ClN3O4S — CID 4257487
N-[5-[(4-chlorophenyl)sulfamoyl]-2-piperidin-1-ylphenyl]-3-phenoxybenzamide (PubChem CID 4257487) has the molecular formula C30H28ClN3O4S and a molecular weight of 562.09 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)sulfamoyl]-2-piperidin-1-ylphenyl]-3-phenoxybenzamide.
| Compound Name | N-[5-[(4-chlorophenyl)sulfamoyl]-2-piperidin-1-ylphenyl]-3-phenoxybenzamide |
|---|---|
| PubChem CID | 4257487 |
| Molecular Formula | C30H28ClN3O4S |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | N-[5-[(4-chlorophenyl)sulfamoyl]-2-piperidin-1-ylphenyl]-3-phenoxybenzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1N1CCCCC1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C30H28ClN3O4S/c31-23-12-14-24(15-13-23)33-39(36,37)27-16-17-29(34-18-5-2-6-19-34)28(21-27)32-30(35)22-8-7-11-26(20-22)38-25-9-3-1-4-10-25/h1,3-4,7-17,20-21,33H,2,5-6,18-19H2,(H,32,35) |
| InChIKey | YZZQKWIXLQQOFD-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |