C22H27ClN4O3S2 — CID 4680841
1-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 4680841) has the molecular formula C22H27ClN4O3S2 and a molecular weight of 495.07 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4680841 |
| Molecular Formula | C22H27ClN4O3S2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | O=S(=O)(Nc1ccc(Cl)cc1)c1ccc(N2CCCC2)c(NC(=S)NCC2CCCO2)c1 |
| InChI | InChI=1S/C22H27ClN4O3S2/c23-16-5-7-17(8-6-16)26-32(28,29)19-9-10-21(27-11-1-2-12-27)20(14-19)25-22(31)24-15-18-4-3-13-30-18/h5-10,14,18,26H,1-4,11-13,15H2,(H2,24,25,31) |
| InChIKey | PAWLLRNUNKMFEN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|