C19H20Cl2N2O4S — CID 43005959
2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 43005959) has the molecular formula C19H20Cl2N2O4S and a molecular weight of 443.35 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 43005959 |
| Molecular Formula | C19H20Cl2N2O4S |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc(NS(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1)NCC1CCCO1 |
| InChI | InChI=1S/C19H20Cl2N2O4S/c20-17-8-7-16(11-18(17)21)28(25,26)23-14-5-3-13(4-6-14)10-19(24)22-12-15-2-1-9-27-15/h3-8,11,15,23H,1-2,9-10,12H2,(H,22,24) |
| InChIKey | FRDATVKSZSJLEI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |