C18H18BrClN2O4S — CID 2083754
5-[(4-bromophenyl)sulfamoyl]-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 2083754) has the molecular formula C18H18BrClN2O4S and a molecular weight of 473.78 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfamoyl]-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 5-[(4-bromophenyl)sulfamoyl]-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 2083754 |
| Molecular Formula | C18H18BrClN2O4S |
| Molecular Weight | 473.78 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | 5-[(4-bromophenyl)sulfamoyl]-2-chloro-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cc(S(=O)(=O)Nc2ccc(Br)cc2)ccc1Cl |
| InChI | InChI=1S/C18H18BrClN2O4S/c19-12-3-5-13(6-4-12)22-27(24,25)15-7-8-17(20)16(10-15)18(23)21-11-14-2-1-9-26-14/h3-8,10,14,22H,1-2,9,11H2,(H,21,23)/t14-/m0/s1 |
| InChIKey | LBPBHDWVIAYCGC-AWEZNQCLSA-N |
| XLogP | 3.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |