C20H20ClIN2O6S — CID 25042472
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate (PubChem CID 25042472) has the molecular formula C20H20ClIN2O6S and a molecular weight of 578.81 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25042472 |
| Molecular Formula | C20H20ClIN2O6S |
| Molecular Weight | 578.81 g/mol |
| Exact Mass | 577.98 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)Nc2ccc(I)cc2)ccc1Cl)NCC1CCCO1 |
| InChI | InChI=1S/C20H20ClIN2O6S/c21-18-8-7-16(31(27,28)24-14-5-3-13(22)4-6-14)10-17(18)20(26)30-12-19(25)23-11-15-2-1-9-29-15/h3-8,10,15,24H,1-2,9,11-12H2,(H,23,25) |
| InChIKey | ZHQNNMRGKSWPEA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|