C20H20Cl2N2O5S — CID 2366758
[2-(cyclopentylamino)-2-oxoethyl] 2-chloro-5-[(4-chlorophenyl)sulfamoyl]benzoate (PubChem CID 2366758) has the molecular formula C20H20Cl2N2O5S and a molecular weight of 471.36 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-chloro-5-[(4-chlorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-chloro-5-[(4-chlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2366758 |
| Molecular Formula | C20H20Cl2N2O5S |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-chloro-5-[(4-chlorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1Cl)NC1CCCC1 |
| InChI | InChI=1S/C20H20Cl2N2O5S/c21-13-5-7-15(8-6-13)24-30(27,28)16-9-10-18(22)17(11-16)20(26)29-12-19(25)23-14-3-1-2-4-14/h5-11,14,24H,1-4,12H2,(H,23,25) |
| InChIKey | NRJHGUVHYFCLHC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |