C20H14Cl2IN3O5S — CID 25041472
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate (PubChem CID 25041472) has the molecular formula C20H14Cl2IN3O5S and a molecular weight of 606.23 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25041472 |
| Molecular Formula | C20H14Cl2IN3O5S |
| Molecular Weight | 606.23 g/mol |
| Exact Mass | 604.91 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)Nc2ccc(I)cc2)ccc1Cl)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C20H14Cl2IN3O5S/c21-12-1-8-18(24-10-12)25-19(27)11-31-20(28)16-9-15(6-7-17(16)22)32(29,30)26-14-4-2-13(23)3-5-14/h1-10,26H,11H2,(H,24,25,27) |
| InChIKey | RJDYIFUWWRDXPQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|