C21H22ClIN2O5S — CID 25039005
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate (PubChem CID 25039005) has the molecular formula C21H22ClIN2O5S and a molecular weight of 576.84 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25039005 |
| Molecular Formula | C21H22ClIN2O5S |
| Molecular Weight | 576.84 g/mol |
| Exact Mass | 576.00 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-[(4-iodophenyl)sulfamoyl]benzoate |
| SMILES | CC1CCCN(C(=O)COC(=O)c2cc(S(=O)(=O)Nc3ccc(I)cc3)ccc2Cl)C1 |
| InChI | InChI=1S/C21H22ClIN2O5S/c1-14-3-2-10-25(12-14)20(26)13-30-21(27)18-11-17(8-9-19(18)22)31(28,29)24-16-6-4-15(23)5-7-16/h4-9,11,14,24H,2-3,10,12-13H2,1H3 |
| InChIKey | GGCSUXGQWVRPMJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|