C15H19ClN2O5S — CID 7994131
[2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 7994131) has the molecular formula C15H19ClN2O5S and a molecular weight of 374.85 g/mol. Its IUPAC name is [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7994131 |
| Molecular Formula | C15H19ClN2O5S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | CC1CCN(C(=O)COC(=O)c2cc(S(N)(=O)=O)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H19ClN2O5S/c1-10-4-6-18(7-5-10)14(19)9-23-15(20)12-8-11(24(17,21)22)2-3-13(12)16/h2-3,8,10H,4-7,9H2,1H3,(H2,17,21,22) |
| InChIKey | NBWYSTGHINHEJT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |