C17H23ClN2O5S — CID 2654403
[2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2654403) has the molecular formula C17H23ClN2O5S and a molecular weight of 402.90 g/mol. Its IUPAC name is [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2654403 |
| Molecular Formula | C17H23ClN2O5S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CC1CCN(C(=O)COC(=O)c2cc(S(=O)(=O)N(C)C)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H23ClN2O5S/c1-12-6-8-20(9-7-12)16(21)11-25-17(22)14-10-13(4-5-15(14)18)26(23,24)19(2)3/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | DIAHJZMHUUBCGL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |