C15H14ClNO5S2 — CID 2524418
(2-oxo-2-thiophen-2-ylethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 2524418) has the molecular formula C15H14ClNO5S2 and a molecular weight of 387.87 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2524418 |
| Molecular Formula | C15H14ClNO5S2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C15H14ClNO5S2/c1-17(2)24(20,21)10-5-6-12(16)11(8-10)15(19)22-9-13(18)14-4-3-7-23-14/h3-8H,9H2,1-2H3 |
| InChIKey | ZVXLVCWJOZXWPA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |