C17H18FNO5S2 — CID 7976129
(4-oxo-4-thiophen-2-ylbutyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7976129) has the molecular formula C17H18FNO5S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 7976129 |
| Molecular Formula | C17H18FNO5S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 5-(dimethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(F)c(C(=O)OCCCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H18FNO5S2/c1-19(2)26(22,23)12-7-8-14(18)13(11-12)17(21)24-9-3-5-15(20)16-6-4-10-25-16/h4,6-8,10-11H,3,5,9H2,1-2H3 |
| InChIKey | BNPRRVRGXLXCFF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|