C22H23NO3S — CID 7175446
(4-oxo-4-thiophen-2-ylbutyl) 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate (PubChem CID 7175446) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7175446 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)OCCCC(=O)c3cccs3)c2C)cc1 |
| InChI | InChI=1S/C22H23NO3S/c1-15-8-10-18(11-9-15)23-16(2)14-19(17(23)3)22(25)26-12-4-6-20(24)21-7-5-13-27-21/h5,7-11,13-14H,4,6,12H2,1-3H3 |
| InChIKey | OFKNXUOUNCIWQU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|