C26H31NO3 — CID 7175431
[2-(1-adamantyl)-2-oxoethyl] 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate (PubChem CID 7175431) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7175431 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 2,5-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxylate |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)OCC(=O)C34CC5CC(CC(C5)C3)C4)c2C)cc1 |
| InChI | InChI=1S/C26H31NO3/c1-16-4-6-22(7-5-16)27-17(2)8-23(18(27)3)25(29)30-15-24(28)26-12-19-9-20(13-26)11-21(10-19)14-26/h4-8,19-21H,9-15H2,1-3H3 |
| InChIKey | GKHAJJHKUIHJJY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|