C20H24FN3O5S — CID 35429062
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 35429062) has the molecular formula C20H24FN3O5S and a molecular weight of 437.49 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 35429062 |
| Molecular Formula | C20H24FN3O5S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)N2CCN(S(C)(=O)=O)CC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN3O5S/c1-14-12-18(15(2)24(14)17-6-4-16(21)5-7-17)20(26)29-13-19(25)22-8-10-23(11-9-22)30(3,27)28/h4-7,12H,8-11,13H2,1-3H3 |
| InChIKey | XKYPKMKRTVYWAT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|