C22H26FN3O5 — CID 41399314
ethyl 4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]oxyacetyl]piperazine-1-carboxylate (PubChem CID 41399314) has the molecular formula C22H26FN3O5 and a molecular weight of 431.46 g/mol. Its IUPAC name is ethyl 4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]oxyacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 41399314 |
| Molecular Formula | C22H26FN3O5 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | ethyl 4-[2-[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]oxyacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)CC1 |
| InChI | InChI=1S/C22H26FN3O5/c1-4-30-22(29)25-11-9-24(10-12-25)20(27)14-31-21(28)19-13-15(2)26(16(19)3)18-7-5-17(23)6-8-18/h5-8,13H,4,9-12,14H2,1-3H3 |
| InChIKey | QUPBFOCTSCJEDD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|