C25H27FN2O3 — CID 2365840
[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 2365840) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 2365840 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | CC[C@H](C)c1ccc(NC(=O)COC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C25H27FN2O3/c1-5-16(2)19-6-10-21(11-7-19)27-24(29)15-31-25(30)23-14-17(3)28(18(23)4)22-12-8-20(26)9-13-22/h6-14,16H,5,15H2,1-4H3,(H,27,29)/t16-/m0/s1 |
| InChIKey | HCGZQVOUCOCPDE-INIZCTEOSA-N |
| XLogP | 5.54 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|