C23H23FN2O5 — CID 4854296
[2-(3,4-dimethoxyanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 4854296) has the molecular formula C23H23FN2O5 and a molecular weight of 426.44 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4854296 |
| Molecular Formula | C23H23FN2O5 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)cc1OC |
| InChI | InChI=1S/C23H23FN2O5/c1-14-11-19(15(2)26(14)18-8-5-16(24)6-9-18)23(28)31-13-22(27)25-17-7-10-20(29-3)21(12-17)30-4/h5-12H,13H2,1-4H3,(H,25,27) |
| InChIKey | APBRPNYZJQPEBD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|