C22H27N3O5 — CID 7274950
ethyl 4-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]oxyacetyl]piperazine-1-carboxylate (PubChem CID 7274950) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl 4-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]oxyacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 7274950 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 4-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]oxyacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COC(=O)c2ccc(-n3c(C)ccc3C)cc2)CC1 |
| InChI | InChI=1S/C22H27N3O5/c1-4-29-22(28)24-13-11-23(12-14-24)20(26)15-30-21(27)18-7-9-19(10-8-18)25-16(2)5-6-17(25)3/h5-10H,4,11-15H2,1-3H3 |
| InChIKey | QNXDMSHYUJQCKG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|