C21H29N3O8S — CID 40855315
ethyl 4-[2-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)oxyacetyl]piperazine-1-carboxylate (PubChem CID 40855315) has the molecular formula C21H29N3O8S and a molecular weight of 483.54 g/mol. Its IUPAC name is ethyl 4-[2-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)oxyacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 40855315 |
| Molecular Formula | C21H29N3O8S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl 4-[2-(4-methoxy-3-pyrrolidin-1-ylsulfonylbenzoyl)oxyacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COC(=O)c2ccc(OC)c(S(=O)(=O)N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C21H29N3O8S/c1-3-31-21(27)23-12-10-22(11-13-23)19(25)15-32-20(26)16-6-7-17(30-2)18(14-16)33(28,29)24-8-4-5-9-24/h6-7,14H,3-5,8-13,15H2,1-2H3 |
| InChIKey | OBSCEYHYNKVTKT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 122.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |