C23H34N2O6S — CID 16509351
[2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate (PubChem CID 16509351) has the molecular formula C23H34N2O6S and a molecular weight of 466.60 g/mol. Its IUPAC name is [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate.
| Compound Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 16509351 |
| Molecular Formula | C23H34N2O6S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [2-[cyclohexyl(methyl)amino]-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)N(C)C2CCCCC2)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H34N2O6S/c1-24(19-10-6-5-7-11-19)22(26)17-31-23(27)18-12-13-20(30-2)21(16-18)32(28,29)25-14-8-3-4-9-15-25/h12-13,16,19H,3-11,14-15,17H2,1-2H3 |
| InChIKey | NWRNBBLTSGHHHM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |