C21H17ClFNO3 — CID 4848808
[2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 4848808) has the molecular formula C21H17ClFNO3 and a molecular weight of 385.82 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4848808 |
| Molecular Formula | C21H17ClFNO3 |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)c2ccc(Cl)cc2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17ClFNO3/c1-13-11-19(14(2)24(13)18-9-7-17(23)8-10-18)21(26)27-12-20(25)15-3-5-16(22)6-4-15/h3-11H,12H2,1-2H3 |
| InChIKey | WEUMPMFMYNEGSQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|