C25H22ClF2NO5 — CID 2435528
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate (PubChem CID 2435528) has the molecular formula C25H22ClF2NO5 and a molecular weight of 489.90 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 2435528 |
| Molecular Formula | C25H22ClF2NO5 |
| Molecular Weight | 489.90 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 4-(4-chlorophenyl)-4-oxobutanoate |
| SMILES | Cc1cc(C(=O)COC(=O)CCC(=O)c2ccc(Cl)cc2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C25H22ClF2NO5/c1-15-13-21(16(2)29(15)19-7-9-20(10-8-19)34-25(27)28)23(31)14-33-24(32)12-11-22(30)17-3-5-18(26)6-4-17/h3-10,13,25H,11-12,14H2,1-2H3 |
| InChIKey | SSKRDABPGBHNTM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.90 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|