C24H23F2NO6S — CID 2414423
[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(benzenesulfonyl)propanoate (PubChem CID 2414423) has the molecular formula C24H23F2NO6S and a molecular weight of 491.51 g/mol. Its IUPAC name is [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(benzenesulfonyl)propanoate.
| Compound Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(benzenesulfonyl)propanoate |
|---|---|
| PubChem CID | 2414423 |
| Molecular Formula | C24H23F2NO6S |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | [2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 3-(benzenesulfonyl)propanoate |
| SMILES | Cc1cc(C(=O)COC(=O)CCS(=O)(=O)c2ccccc2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H23F2NO6S/c1-16-14-21(17(2)27(16)18-8-10-19(11-9-18)33-24(25)26)22(28)15-32-23(29)12-13-34(30,31)20-6-4-3-5-7-20/h3-11,14,24H,12-13,15H2,1-2H3 |
| InChIKey | HUIITTLVFKTBAK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|