C20H24N2O4 — CID 40572132
(2-morpholin-4-yl-2-oxoethyl) 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylate (PubChem CID 40572132) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 40572132 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxylate |
| SMILES | Cc1cccc(-n2c(C)cc(C(=O)OCC(=O)N3CCOCC3)c2C)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-14-5-4-6-17(11-14)22-15(2)12-18(16(22)3)20(24)26-13-19(23)21-7-9-25-10-8-21/h4-6,11-12H,7-10,13H2,1-3H3 |
| InChIKey | HZLKIYQOUCAYAD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|