(2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate

C13H17NO5 — CID 3969226

IUPAC(2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate
SMILESCc1cc(C(=O)OCC(=O)N2CCOCC2)c(C)o1
InChIInChI=1S/C13H17NO5/c1-9-7-11(10(2)19-9)13(16)18-8-12(15)14-3-5-17-6-4-14/h7H,3-6,8H2,1-2H3
InChIKeyRXKDPTGNVGGTGO-UHFFFAOYSA-N
MW267.28 g/mol
LogP0.91
Rot. Bonds3

About (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate

(2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate (PubChem CID 3969226) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate.

Molecular Properties

Compound Name(2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate
PubChem CID3969226
Molecular FormulaC13H17NO5
Molecular Weight267.28 g/mol
Exact Mass267.11
IUPAC Name(2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate
SMILESCc1cc(C(=O)OCC(=O)N2CCOCC2)c(C)o1
InChIInChI=1S/C13H17NO5/c1-9-7-11(10(2)19-9)13(16)18-8-12(15)14-3-5-17-6-4-14/h7H,3-6,8H2,1-2H3
InChIKeyRXKDPTGNVGGTGO-UHFFFAOYSA-N
XLogP0.91
TPSA68.98 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.28
LogP ≤ 50.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate?
The IUPAC name of (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate (CID 3969226) is (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate.
What is the SMILES notation for (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate?
The canonical SMILES for (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate is Cc1cc(C(=O)OCC(=O)N2CCOCC2)c(C)o1.
What is the InChIKey of (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate?
The InChIKey is RXKDPTGNVGGTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-9-7-11(10(2)19-9)13(16)18-8-12(15)14-3-5-17-6-4-14/h7H,3-6,8H2,1-2H3.
What are the key properties of (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate?
(2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate has a molecular weight of 267.28 g/mol, XLogP of 0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-morpholin-4-yl-2-oxoethyl) 2,5-dimethylfuran-3-carboxylate is sourced from PubChem (CID 3969226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).