C14H16BrFN2O5S — CID 36791037
[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-bromo-2-fluorobenzoate (PubChem CID 36791037) has the molecular formula C14H16BrFN2O5S and a molecular weight of 423.26 g/mol. Its IUPAC name is [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-bromo-2-fluorobenzoate.
| Compound Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
|---|---|
| PubChem CID | 36791037 |
| Molecular Formula | C14H16BrFN2O5S |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | [2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl] 5-bromo-2-fluorobenzoate |
| SMILES | CS(=O)(=O)N1CCN(C(=O)COC(=O)c2cc(Br)ccc2F)CC1 |
| InChI | InChI=1S/C14H16BrFN2O5S/c1-24(21,22)18-6-4-17(5-7-18)13(19)9-23-14(20)11-8-10(15)2-3-12(11)16/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | GEMCQHOMYQOUQU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |