C16H21BrN2O3 — CID 7149290
[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-amino-5-bromobenzoate (PubChem CID 7149290) has the molecular formula C16H21BrN2O3 and a molecular weight of 369.26 g/mol. Its IUPAC name is [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-amino-5-bromobenzoate.
| Compound Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-amino-5-bromobenzoate |
|---|---|
| PubChem CID | 7149290 |
| Molecular Formula | C16H21BrN2O3 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 2-amino-5-bromobenzoate |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)COC(=O)c2cc(Br)ccc2N)C1 |
| InChI | InChI=1S/C16H21BrN2O3/c1-10-5-11(2)8-19(7-10)15(20)9-22-16(21)13-6-12(17)3-4-14(13)18/h3-4,6,10-11H,5,7-9,18H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | MWFZNXGBDJALOS-QWRGUYRKSA-N |
| XLogP | 2.69 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|