C18H22BrNO3 — CID 7971857
[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 7971857) has the molecular formula C18H22BrNO3 and a molecular weight of 380.28 g/mol. Its IUPAC name is [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7971857 |
| Molecular Formula | C18H22BrNO3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)COC(=O)/C=C/c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H22BrNO3/c1-13-9-14(2)11-20(10-13)17(21)12-23-18(22)8-5-15-3-6-16(19)7-4-15/h3-8,13-14H,9-12H2,1-2H3/b8-5+/t13-,14-/m0/s1 |
| InChIKey | BVDCUPZQXIZFDY-NSDHSQQOSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|