C16H20INO4 — CID 23824756
[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-iodobenzoate (PubChem CID 23824756) has the molecular formula C16H20INO4 and a molecular weight of 417.24 g/mol. Its IUPAC name is [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-iodobenzoate.
| Compound Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-iodobenzoate |
|---|---|
| PubChem CID | 23824756 |
| Molecular Formula | C16H20INO4 |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-iodobenzoate |
| SMILES | CC1CC(C)CN(C(=O)COC(=O)c2cc(I)ccc2O)C1 |
| InChI | InChI=1S/C16H20INO4/c1-10-5-11(2)8-18(7-10)15(20)9-22-16(21)13-6-12(17)3-4-14(13)19/h3-4,6,10-11,19H,5,7-9H2,1-2H3 |
| InChIKey | DYYMLNYUHQORDV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|