C21H26O3 — CID 7793884
[2-(1-adamantyl)-2-oxoethyl] 3,4-dimethylbenzoate (PubChem CID 7793884) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 3,4-dimethylbenzoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7793884 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)C23CC4CC(CC(C4)C2)C3)cc1C |
| InChI | InChI=1S/C21H26O3/c1-13-3-4-18(5-14(13)2)20(23)24-12-19(22)21-9-15-6-16(10-21)8-17(7-15)11-21/h3-5,15-17H,6-12H2,1-2H3 |
| InChIKey | KKDBXJWSJKWMPB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |