C27H31NO5S — CID 25040903
[2-(1-adamantyl)-2-oxoethyl] 4-[(2,5-dimethylphenyl)sulfonylamino]benzoate (PubChem CID 25040903) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 4-[(2,5-dimethylphenyl)sulfonylamino]benzoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 4-[(2,5-dimethylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 25040903 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 4-[(2,5-dimethylphenyl)sulfonylamino]benzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(C(=O)OCC(=O)C34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C27H31NO5S/c1-17-3-4-18(2)24(9-17)34(31,32)28-23-7-5-22(6-8-23)26(30)33-16-25(29)27-13-19-10-20(14-27)12-21(11-19)15-27/h3-9,19-21,28H,10-16H2,1-2H3 |
| InChIKey | DGONJDNEBKTTEO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |