C23H29NO6S — CID 27702712
[2-(1-adamantyl)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 27702712) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 27702712 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)C23CC4CC(CC(C4)C2)C3)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C23H29NO6S/c1-29-19-5-2-17(9-20(19)31(27,28)24-18-3-4-18)22(26)30-13-21(25)23-10-14-6-15(11-23)8-16(7-14)12-23/h2,5,9,14-16,18,24H,3-4,6-8,10-13H2,1H3 |
| InChIKey | PHMXJPUJFKAFRP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |