C18H18FNO5S — CID 7991073
(2-fluorophenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 7991073) has the molecular formula C18H18FNO5S and a molecular weight of 379.41 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | (2-fluorophenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 7991073 |
| Molecular Formula | C18H18FNO5S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (2-fluorophenyl)methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2ccccc2F)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C18H18FNO5S/c1-24-16-9-6-12(10-17(16)26(22,23)20-14-7-8-14)18(21)25-11-13-4-2-3-5-15(13)19/h2-6,9-10,14,20H,7-8,11H2,1H3 |
| InChIKey | BDMMUXSIZLGFMD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |