C25H22N2O5S — CID 30292306
[4-(2-cyanophenyl)phenyl]methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate (PubChem CID 30292306) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is [4-(2-cyanophenyl)phenyl]methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate.
| Compound Name | [4-(2-cyanophenyl)phenyl]methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 30292306 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | [4-(2-cyanophenyl)phenyl]methyl 3-(cyclopropylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2ccc(-c3ccccc3C#N)cc2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C25H22N2O5S/c1-31-23-13-10-19(14-24(23)33(29,30)27-21-11-12-21)25(28)32-16-17-6-8-18(9-7-17)22-5-3-2-4-20(22)15-26/h2-10,13-14,21,27H,11-12,16H2,1H3 |
| InChIKey | JDRAXDMLLZJENF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |